CAS 78987-78-7
:ethyl 2-benzylcyclopropanecarboxylate
Description:
Ethyl 2-benzylcyclopropanecarboxylate is an organic compound characterized by its unique cyclopropane structure, which is a three-membered carbon ring. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of the benzyl group enhances its aromatic characteristics, potentially influencing its interactions in chemical reactions and biological systems. Ethyl 2-benzylcyclopropanecarboxylate is typically a colorless to pale yellow liquid with a pleasant odor, making it suitable for various applications in the fragrance and flavor industries. Its molecular structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound's stability and reactivity can be influenced by factors such as temperature and the presence of catalysts. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, ethyl 2-benzylcyclopropanecarboxylate is a versatile compound with interesting chemical properties.
Formula:C13H16O2
InChI:InChI=1/C13H16O2/c1-2-15-13(14)12-9-11(12)8-10-6-4-3-5-7-10/h3-7,11-12H,2,8-9H2,1H3
SMILES:CCOC(=O)C1CC1Cc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.