CAS 78987-82-3
:5-methyl-1-phenylhexan-3-one
Description:
5-Methyl-1-phenylhexan-3-one, with the CAS number 78987-82-3, is an organic compound classified as a ketone. It features a hexane backbone with a phenyl group and a methyl substituent, contributing to its unique structural characteristics. This compound is typically a colorless to pale yellow liquid with a pleasant odor, making it useful in various applications, including as a flavoring agent or fragrance. Its molecular structure includes a carbonyl group (C=O), which is characteristic of ketones, influencing its reactivity and interactions with other substances. The presence of both aliphatic and aromatic components in its structure can lead to interesting chemical properties, such as moderate solubility in organic solvents and limited solubility in water. Additionally, 5-methyl-1-phenylhexan-3-one may exhibit moderate volatility, which can affect its handling and storage. Safety data should be consulted for proper handling, as with all chemical substances, to ensure safe usage in laboratory or industrial settings.
Formula:C13H18O
InChI:InChI=1/C13H18O/c1-11(2)10-13(14)9-8-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3
SMILES:CC(C)CC(=O)CCc1ccccc1
Synonyms:- 3-Hexanone, 5-Methyl-1-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.