CAS 78994-23-7

(-)-Centchroman

Description:

(-)-Centchroman, with the CAS number 78994-23-7, is a synthetic compound primarily recognized for its use as a non-steroidal contraceptive and potential therapeutic agent. It belongs to the class of compounds known as chromans, characterized by a chromene structure that includes a benzene ring fused to a saturated heterocyclic ring. This compound exhibits a chiral center, leading to its designation as (-)-Centchroman, indicating its specific enantiomeric form. The substance is known for its ability to interact with estrogen receptors, which contributes to its contraceptive properties. Additionally, it has been studied for its potential in treating conditions such as endometriosis and certain types of cancer due to its anti-estrogenic effects. (-)-Centchroman is typically administered orally and has a favorable pharmacokinetic profile, including good bioavailability. Its safety and efficacy have been subjects of various clinical studies, making it a compound of interest in both reproductive health and oncology research.

Formula: C₃₀H₃₅NO₃

InChI: InChI=1S/C30H35NO3/c1-30(2)29(23-9-5-4-6-10-23)28(26-16-15-25(32-3)21-27(26)34-30)22-11-13-24(14-12-22)33-20-19-31-17-7-8-18-31/h4-6,9-16,21,28-29H,7-8,17-20H2,1-3H3/t28-,29+/m1/s1

InChI key: InChIKey=XZEUAXYWNKYKPL-WDYNHAJCSA-N

SMILES: CC1(C)[C@H]([C@@H](C=2C(O1)=CC(OC)=CC2)C3=CC=C(OCCN4CCCC4)C=C3)C5=CC=CC=C5

Synonyms:

• (-)-Centchroman
• 1-[2-[4-[(3R,4R)-3,4-Dihydro-7-methoxy-2,2-dimethyl-3-phenyl-2H-1-benzopyran-4-yl]phenoxy]ethyl]pyrrolidine
• Levormeloxifene
• Pyrrolidine,1-[2-[4-(3,4-dihydro-7-methoxy-2,2-dimethyl-3-phenyl-2H-1-benzopyran-4-yl)phenoxy]ethyl]-,(3R-trans)-
• l-Centchroman
• Pyrrolidine, 1-[2-[4-[(3R,4R)-3,4-dihydro-7-methoxy-2,2-dimethyl-3-phenyl-2H-1-benzopyran-4-yl]phenoxy]ethyl]-

L-Centchroman

Controlled Product

CAS: 78994-23-7

Formula: C₃₀H₃₅NO₃

Color and Shape: Neat

Molecular weight: 457.604

Ref: TR-C256605

Levormeloxifene

CAS: 78994-23-7

Levormeloxifene is a selective modulator of the estrogen receptor. It inhibits the production of vaginal tropoelastin and transforming growth factor-beta 1.

Formula: C₃₀H₃₅NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 457.6

Ref: TM-T25700