CAS 79-14-1: Glycolic acid

Description:Glycolic acid, with the CAS number 79-14-1, is a colorless, odorless organic compound classified as an alpha hydroxy acid (AHA). It is the simplest AHA, featuring a two-carbon backbone with a hydroxyl group (-OH) and a carboxylic acid group (-COOH), which contributes to its acidic properties. Glycolic acid is highly soluble in water, making it effective for various applications, particularly in the cosmetic and pharmaceutical industries. It is commonly used in skincare products for its exfoliating properties, promoting cell turnover and improving skin texture. Additionally, glycolic acid is utilized in chemical peels and treatments for acne and hyperpigmentation. Its small molecular size allows for better penetration into the skin compared to other AHAs. In terms of safety, glycolic acid can cause irritation at higher concentrations, so it is essential to use it with caution and follow recommended guidelines. Overall, glycolic acid is valued for its versatility and effectiveness in both industrial and cosmetic applications.

Formula:C₂H₄O₃

InChI:InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)

InChI key:InChIKey=AEMRFAOFKBGASW-UHFFFAOYSA-N

SMILES:O=C(O)CO