CAS 79-55-0: 1,2,2,6,6-Pentamethylpiperidine
Description:1,2,2,6,6-Pentamethylpiperidine is a cyclic organic compound characterized by its piperidine structure, which is a six-membered ring containing one nitrogen atom. This compound features five methyl groups attached to the piperidine ring, specifically at the 1, 2, and 6 positions, contributing to its unique properties. It is a colorless to pale yellow liquid with a distinctive odor and is known for its relatively low volatility. The presence of multiple methyl groups enhances its steric bulk and can influence its reactivity and solubility in various solvents. 1,2,2,6,6-Pentamethylpiperidine is often used as a reagent in organic synthesis and as a stabilizer in polymer chemistry due to its ability to scavenge free radicals. It is important to handle this compound with care, as it may pose health risks upon exposure. Overall, its unique structure and properties make it a valuable compound in various chemical applications.
Formula:C10H21N
InChI:InChI=1S/C10H21N/c1-9(2)7-6-8-10(3,4)11(9)5/h6-8H2,1-5H3
InChI key:InChIKey=XULIXFLCVXWHRF-UHFFFAOYSA-N
SMILES:N1(C)C(C)(C)CCCC1(C)C
- Synonyms:
- 1,2,2,6,6-Pentamethylpiperidinium
- 2,2,6,6,N-Pentamethylpiperidine
- 79-55-0
- M&B 4486
- N,2,2,6,6-Pentamethylpiperidine
- N-Methyl-2,2,6,6-tetramethylpiperidine
- Pempidine
- Piperidine, 1,2,2,6,6-pentamethyl-
- Pyrilene
- 1,2,2,6,6-PENTAMETHYLPIPERIDINE
- See more synonyms
- 1,2,2,6,6-Pentamethylpiperidine
