CAS 79-63-0: Lanosterol
Description:Lanosterol is a tetracyclic triterpenoid and a key intermediate in the biosynthesis of sterols, including cholesterol. It is derived from squalene through a series of enzymatic reactions in the mevalonate pathway. Lanosterol has a complex structure characterized by four fused rings, which contributes to its biological significance. It is typically a white crystalline solid at room temperature and is insoluble in water but soluble in organic solvents such as ethanol and chloroform. Lanosterol plays a crucial role in the formation of various steroid hormones and is involved in cellular membrane structure and function. Additionally, it has been studied for its potential therapeutic properties, including its role in modulating cholesterol metabolism and its implications in certain diseases. The compound is also of interest in the field of biochemistry and pharmacology due to its involvement in the synthesis of other biologically important molecules. Overall, lanosterol is a vital compound in both biological systems and industrial applications.
Formula:C30H50O
InChI:InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1
InChI key:InChIKey=CAHGCLMLTWQZNJ-BQNIITSRSA-N
SMILES:OC1CCC2(C3=C(CCC2C1(C)C)C4(C)CCC(C(C)CCC=C(C)C)C4(C)CC3)C
- Synonyms:
- (3β)-Lanosta-8,24-dien-3-ol
- 3β-Hydroxy-lansota-8,24-dien-21-oic acid
- 3β-Hydroxylanosta-8,24-diene
- 4,4,14α-Trimethylcholesta-8,24-dien-3β-ol
- 5α-Lanosta-8,24-dien-3β-ol
- Lanosta-8,24-dien-3β-ol
- Lanosta-8,24-dienol
- Lanostadien-3β-ol
- Lanosterin
- Lanosterol
- See more synonyms
- Lanster
- Nsc 60677
- Lanosta-8,24-dien-3-ol, (3β)-
