CymitQuimica logo

CAS 79002-96-3

:

5-amino-1-(2,4,6-trichlorophenyl)-1H-pyrazole-4-carbonitrile

Description:
5-amino-1-(2,4,6-trichlorophenyl)-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of an amino group and a carbonitrile group contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound features a 2,4,6-trichlorophenyl substituent, which enhances its biological activity and lipophilicity due to the electron-withdrawing nature of the chlorine atoms. This structure may impart specific properties such as increased potency or selectivity in biological systems. The compound is typically synthesized through multi-step organic reactions, and its properties can be influenced by factors such as pH, solvent, and temperature. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated compounds.
Formula:C10H5Cl3N4
InChI:InChI=1/C10H5Cl3N4/c11-6-1-7(12)9(8(13)2-6)17-10(15)5(3-14)4-16-17/h1-2,4H,15H2
SMILES:c1c(cc(c(c1Cl)n1c(c(C#N)cn1)N)Cl)Cl
Synonyms:
  • 1H-Pyrazole-4-carbonitrile, 5-amino-1-(2,4,6-trichlorophenyl)-
  • 5-Amino-1-(2,4,6-trichlorophenyl)-1H-pyrazole-4-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.