CymitQuimica logo

CAS 79005-54-2

:

4-chloro-3-(chlorosulfonyl)benzenesulfonyl fluoride

Description:
4-Chloro-3-(chlorosulfonyl)benzenesulfonyl fluoride, with the CAS number 79005-54-2, is a chemical compound characterized by its sulfonyl fluoride and chlorosulfonyl functional groups. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the presence of both sulfonyl and halogen substituents. It is often utilized in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The chlorosulfonyl group enhances its electrophilic character, making it a useful reagent in various chemical transformations. Additionally, the presence of chlorine atoms contributes to its potential applications in the synthesis of chlorinated compounds. Safety precautions are essential when handling this substance, as it may pose health risks through inhalation or skin contact, and it should be stored in a cool, dry place away from incompatible materials. Overall, 4-chloro-3-(chlorosulfonyl)benzenesulfonyl fluoride is a valuable compound in synthetic chemistry, particularly in the development of complex organic molecules.
Formula:C6H3Cl2FO4S2
InChI:InChI=1/C6H3Cl2FO4S2/c7-5-2-1-4(15(9,12)13)3-6(5)14(8,10)11/h1-3H
SMILES:c1cc(c(cc1S(=O)(=O)F)S(=O)(=O)Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.