CAS 79005-58-6
:4-(prop-2-en-1-yloxy)pyrimidin-2-amine
Description:
4-(Prop-2-en-1-yloxy)pyrimidin-2-amine, with the CAS number 79005-58-6, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amine group (-NH2) at the 2-position of the pyrimidine ring, contributing to its basicity and potential reactivity. The presence of the prop-2-en-1-yloxy group at the 4-position introduces an alkene functionality, which can participate in various chemical reactions, such as polymerization or cross-coupling reactions. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the amine group, while the alkenyl ether may influence its reactivity and stability. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, where pyrimidine derivatives are often explored for their biological activity. Overall, this compound's characteristics make it a subject of interest for further research and application in various chemical fields.
Formula:C7H9N3O
InChI:InChI=1/C7H9N3O/c1-2-5-11-6-3-4-9-7(8)10-6/h2-4H,1,5H2,(H2,8,9,10)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.