
CAS 79017-08-6
:(3R)-3-[(1R)-1-nitroethyl]-2-benzofuran-1(3H)-one
Description:
The chemical substance known as (3R)-3-[(1R)-1-nitroethyl]-2-benzofuran-1(3H)-one, with the CAS number 79017-08-6, is a compound that features a benzofuran core, which is a fused bicyclic structure consisting of a benzene ring and a furan ring. This compound is characterized by the presence of a nitroethyl substituent, which contributes to its reactivity and potential biological activity. The specific stereochemistry indicated by the (3R) and (1R) designations suggests that the compound has chiral centers, which can influence its pharmacological properties and interactions with biological systems. Typically, compounds like this may exhibit various properties such as solubility in organic solvents, potential for biological activity, and specific reactivity patterns due to the functional groups present. The presence of the nitro group may also suggest potential applications in medicinal chemistry or as a synthetic intermediate. Overall, the characteristics of this compound make it of interest in both research and potential therapeutic applications.
Formula:C10H9NO4
InChI:InChI=1/C10H9NO4/c1-6(11(13)14)9-7-4-2-3-5-8(7)10(12)15-9/h2-6,9H,1H3/t6-,9+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(1-Nitroethyl)-2-benzofuran-1(3H)-one
CAS:Controlled ProductStability Hygroscopic
Applications 3-(1-Nitroethyl)-2-benzofuran-1(3H)-one (cas# 79017-08-6) is a useful research chemical.Formula:C10H9NO4Color and Shape:Off-White To BeigeMolecular weight:207.2

