
CAS 790204-05-6
:1-Imidazo[1,2-a]pyridin-3-yl-1-propanone
Description:
1-Imidazo[1,2-a]pyridin-3-yl-1-propanone is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and pyridine rings. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the ketone functional group (propanone) suggests that it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the compound may exhibit fluorescence properties, which can be useful in analytical applications. As with many heterocycles, the specific reactivity and stability can be influenced by substituents on the rings and the overall electronic environment. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-2-9(13)8-7-11-10-5-3-4-6-12(8)10/h3-7H,2H2,1H3
InChI key:InChIKey=KNCRUVAVBAKAED-UHFFFAOYSA-N
SMILES:C(CC)(=O)C=1N2C(=NC1)C=CC=C2
Synonyms:- 1-Propanone, 1-imidazo[1,2-a]pyridin-3-yl-
- 1-Imidazo[1,2-a]pyridin-3-yl-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.