CAS 790207-00-0
:ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate
Description:
Ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate is a chemical compound characterized by its oxadiazole ring, which contributes to its potential biological activity. The presence of the aminoethyl group suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a building block for pharmaceuticals or agrochemicals. The ethyl ester functional group indicates that it can undergo hydrolysis, making it reactive in various chemical environments. This compound may also exhibit polar characteristics due to the carboxylate group, influencing its solubility in polar solvents. Additionally, the oxadiazole moiety is known for its role in various biological activities, including antimicrobial and anti-inflammatory properties. The compound's structure suggests potential interactions with biological targets, making it of interest in drug discovery and development. Overall, ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C7H11N3O3
InChI:InChI=1/C7H11N3O3/c1-2-12-7(11)6-9-5(3-4-8)13-10-6/h2-4,8H2,1H3
SMILES:CCOC(=O)c1nc(CCN)on1
Synonyms:- 1,2,4-Oxadiazole-3-Carboxylic Acid, 5-(2-Aminoethyl)-, Ethyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
