
CAS 790227-20-2
:γ-Amino-2,4-difluorobenzenepropanol
Description:
γ-Amino-2,4-difluorobenzenepropanol, identified by its CAS number 790227-20-2, is a chemical compound characterized by the presence of an amino group and a propanol moiety attached to a difluorobenzene ring. This compound features two fluorine atoms positioned at the 2 and 4 positions of the benzene ring, which can significantly influence its chemical reactivity and physical properties, such as polarity and solubility. The amino group contributes to its potential as a building block in pharmaceuticals and agrochemicals, as it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the hydroxyl group in the propanol structure enhances its ability to form hydrogen bonds, affecting its solubility in polar solvents. Overall, γ-Amino-2,4-difluorobenzenepropanol exhibits unique characteristics that make it of interest in synthetic organic chemistry and medicinal chemistry applications.
Formula:C9H11F2NO
InChI:InChI=1S/C9H11F2NO/c10-6-1-2-7(8(11)5-6)9(12)3-4-13/h1-2,5,9,13H,3-4,12H2
InChI key:InChIKey=NYJUMGOILSWHAV-UHFFFAOYSA-N
SMILES:C(CCO)(N)C1=C(F)C=C(F)C=C1
Synonyms:- Benzenepropanol, γ-amino-2,4-difluoro-
- γ-Amino-2,4-difluorobenzenepropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.