CAS 790232-11-0

2-[(2-Chloroethyl)sulfonyl]-1,4-dimethylbenzene

Description:

2-[(2-Chloroethyl)sulfonyl]-1,4-dimethylbenzene, identified by its CAS number 790232-11-0, is an organic compound characterized by the presence of a sulfonyl group attached to a dimethyl-substituted benzene ring. The structure features a chloroethyl group, which contributes to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit properties typical of sulfonyl compounds, such as being polar and having the ability to participate in nucleophilic substitution reactions due to the presence of the sulfonyl moiety. The chloroethyl group may also impart certain biological activities, making it of interest in medicinal chemistry. Additionally, the dimethyl substitution on the benzene ring can influence the compound's steric and electronic properties, affecting its solubility and reactivity. Overall, this compound's unique structure suggests potential utility in various chemical applications, including as an intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of chlorine and potential toxicity associated with sulfonyl compounds.

Formula: C₁₀H₁₃ClO₂S

InChI: InChI=1S/C10H13ClO2S/c1-8-3-4-9(2)10(7-8)14(12,13)6-5-11/h3-4,7H,5-6H2,1-2H3

InChI key: InChIKey=HLINWILSHIFWQK-UHFFFAOYSA-N

SMILES: S(CCCl)(=O)(=O)C1=C(C)C=CC(C)=C1

Synonyms:

• 2-[(2-Chloroethyl)sulfonyl]-1,4-dimethylbenzene
• Benzene, 2-[(2-chloroethyl)sulfonyl]-1,4-dimethyl-