
CAS 790232-15-4
:2-(4-Bromophenoxy)acetic acid 2-(2-chloroacetyl)hydrazide
Description:
2-(4-Bromophenoxy)acetic acid 2-(2-chloroacetyl)hydrazide is a chemical compound characterized by its complex structure, which includes both a bromophenoxy group and a hydrazide moiety. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The bromophenoxy group may impart specific electronic and steric effects, influencing its reactivity and interactions with biological systems. The presence of the chloroacetyl group suggests potential for acylation reactions, making it a candidate for further chemical modifications. Additionally, compounds of this nature may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular structure allows for various applications, including potential use in agrochemicals or as intermediates in organic synthesis. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C10H10BrClN2O3
InChI:InChI=1S/C10H10BrClN2O3/c11-7-1-3-8(4-2-7)17-6-10(16)14-13-9(15)5-12/h1-4H,5-6H2,(H,13,15)(H,14,16)
InChI key:InChIKey=CQSOWNMDSBLCGV-UHFFFAOYSA-N
SMILES:O(CC(NNC(CCl)=O)=O)C1=CC=C(Br)C=C1
Synonyms:- 2-(4-Bromophenoxy)acetic acid 2-(2-chloroacetyl)hydrazide
- Acetic acid, (4-bromophenoxy)-, 2-(chloroacetyl)hydrazide
- Acetic acid, 2-(4-bromophenoxy)-, 2-(2-chloroacetyl)hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.