CAS 79026-43-0
:(6-amino-8a-hydroxy-1,5-dimethyl-4,7-dioxo-1,1a,2,4,7,8,8a,8b-octahydroazireno[2',3':3,4]pyrrolo[1,2-a]indol-8-yl)methyl carbamate
Description:
The chemical substance with the name "(6-amino-8a-hydroxy-1,5-dimethyl-4,7-dioxo-1,1a,2,4,7,8,8a,8b-octahydroazireno[2',3':3,4]pyrrolo[1,2-a]indol-8-yl)methyl carbamate" and CAS number "79026-43-0" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as amino, hydroxy, and carbamate. This compound features a fused ring system that incorporates both azireno and pyrrolo moieties, contributing to its potential biological activity. The presence of the dimethyl and dioxo groups suggests that it may exhibit unique reactivity and stability profiles. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial or anticancer activities. The specific stereochemistry and substituent positions can significantly influence the compound's biological interactions and efficacy. As with many complex organic molecules, detailed studies, including spectroscopic analysis and biological assays, would be necessary to fully elucidate its properties and potential applications.
Formula:C15H18N4O5
InChI:InChI=1/C15H18N4O5/c1-5-9(16)12(21)8-6(4-24-14(17)22)15(23)13-7(18(13)2)3-19(15)10(8)11(5)20/h6-7,13,23H,3-4,16H2,1-2H3,(H2,17,22)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
