CymitQuimica logo

CAS 790263-26-2

:

5-(2-Bromophenyl)-N-(1-methylethyl)-1,3,4-oxadiazole-2-methanamine

Description:
5-(2-Bromophenyl)-N-(1-methylethyl)-1,3,4-oxadiazole-2-methanamine is a chemical compound characterized by its unique structure, which includes an oxadiazole ring, a bromophenyl group, and an isopropyl amine moiety. The presence of the oxadiazole ring imparts specific electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. The bromophenyl substituent can enhance the compound's reactivity and solubility, while the isopropyl amine group may contribute to its biological activity. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic and aliphatic components, which can influence its pharmacokinetic properties. Additionally, the presence of the bromine atom may provide opportunities for further functionalization or reactivity in synthetic applications. Overall, this compound's structural features suggest potential utility in drug development or as a building block in organic synthesis. However, specific biological activity and safety profiles would require further investigation through empirical studies.
Formula:C12H14BrN3O
InChI:InChI=1S/C12H14BrN3O/c1-8(2)14-7-11-15-16-12(17-11)9-5-3-4-6-10(9)13/h3-6,8,14H,7H2,1-2H3
InChI key:InChIKey=NXLKIDDFWSPYIP-UHFFFAOYSA-N
SMILES:BrC1=C(C=2OC(CNC(C)C)=NN2)C=CC=C1
Synonyms:
  • 1,3,4-Oxadiazole-2-methanamine, 5-(2-bromophenyl)-N-(1-methylethyl)-
  • 5-(2-Bromophenyl)-N-(1-methylethyl)-1,3,4-oxadiazole-2-methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.