
CAS 790263-35-3
:3-[2-(1H-Indol-1-yl)ethyl]-1,2,4-oxadiazole-5-acetonitrile
Description:
3-[2-(1H-Indol-1-yl)ethyl]-1,2,4-oxadiazole-5-acetonitrile, with the CAS number 790263-35-3, is a chemical compound characterized by its unique structural features, which include an indole moiety and an oxadiazole ring. The presence of the indole group suggests potential biological activity, as indoles are known for their roles in various pharmacological applications. The oxadiazole ring contributes to the compound's stability and may influence its electronic properties, making it of interest in materials science and medicinal chemistry. The acetonitrile functional group enhances its solubility in polar solvents, which is advantageous for various chemical reactions and applications. This compound may exhibit properties such as fluorescence or specific reactivity due to its heterocyclic structure. Additionally, its potential interactions with biological targets could be explored in drug development, particularly in the context of cancer research or neuropharmacology, given the significance of indole derivatives in these fields. Overall, this compound represents a fascinating intersection of organic chemistry and pharmacology.
Formula:C14H12N4O
InChI:InChI=1S/C14H12N4O/c15-8-5-14-16-13(17-19-14)7-10-18-9-6-11-3-1-2-4-12(11)18/h1-4,6,9H,5,7,10H2
InChI key:InChIKey=GEEZOSKDOOZZIG-UHFFFAOYSA-N
SMILES:C(CC=1N=C(CC#N)ON1)N2C=3C(C=C2)=CC=CC3
Synonyms:- 1,2,4-Oxadiazole-5-acetonitrile, 3-[2-(1H-indol-1-yl)ethyl]-
- 3-[2-(1H-Indol-1-yl)ethyl]-1,2,4-oxadiazole-5-acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.