CAS 790263-42-2

2-[(Cyclohexylcarbonyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid

Description:

2-[(Cyclohexylcarbonyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid, with the CAS number 790263-42-2, is a chemical compound characterized by its unique bicyclic structure that incorporates both a thiophene and a cyclopentane moiety. This compound features an amino group attached to a cyclohexylcarbonyl group, which contributes to its potential as a bioactive molecule. The presence of a carboxylic acid functional group indicates that it can participate in various chemical reactions, such as esterification or amidation. Its structural complexity may confer specific pharmacological properties, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can be influenced by the substituents on the thiophene and cyclopentane rings, as well as the overall steric and electronic environment. While specific physical properties like melting point or solubility are not provided, compounds of this nature often exhibit interesting interactions in biological systems, warranting further investigation for potential therapeutic applications.

Formula: C₁₅H₁₉NO₃S

InChI: InChI=1S/C15H19NO3S/c17-13(9-5-2-1-3-6-9)16-14-12(15(18)19)10-7-4-8-11(10)20-14/h9H,1-8H2,(H,16,17)(H,18,19)

InChI key: InChIKey=OSJJBTBVDMMNOY-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(SC1NC(=O)C3CCCCC3)CCC2

Synonyms:

• 4H-Cyclopenta[b]thiophene-3-carboxylic acid, 2-[(cyclohexylcarbonyl)amino]-5,6-dihydro-
• 2-[(Cyclohexylcarbonyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid