CymitQuimica logo

CAS 790263-43-3

:

2-furan-2-yl-2-pyrrolidin-1-ylethanamine

Description:
2-Furan-2-yl-2-pyrrolidin-1-ylethanamine, with the CAS number 790263-43-3, is a chemical compound that features a furan ring and a pyrrolidine moiety, indicating its potential for diverse biological activity. This compound is characterized by its nitrogen-containing heterocycles, which can influence its pharmacological properties. The presence of the furan ring suggests potential reactivity due to its electron-rich nature, making it a candidate for various chemical reactions, including electrophilic substitutions. The pyrrolidine structure contributes to its conformational flexibility, which may affect its interaction with biological targets. Additionally, the amine functional group can participate in hydrogen bonding, enhancing its solubility in polar solvents and influencing its bioavailability. Overall, the unique combination of these structural features may provide insights into its potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C10H16N2O
InChI:InChI=1/C10H16N2O/c11-8-9(10-4-3-7-13-10)12-5-1-2-6-12/h3-4,7,9H,1-2,5-6,8,11H2
SMILES:C1CCN(C1)C(CN)c1ccco1
Synonyms:
  • 1-Pyrrolidineethanamine, Beta-2-Furanyl-
  • 2-(2-Furyl)-2-(pyrrolidin-1-yl)ethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.