CymitQuimica logo

CAS 790263-63-7

:

4-(4-Fluorophenyl)-2,4-dihydro-5-(1-pyrrolidinylmethyl)-3H-1,2,4-triazole-3-thione

Description:
4-(4-Fluorophenyl)-2,4-dihydro-5-(1-pyrrolidinylmethyl)-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. The presence of a fluorophenyl group enhances its lipophilicity and may influence its biological activity. The pyrrolidinylmethyl substituent contributes to its potential pharmacological properties, possibly enhancing interactions with biological targets. This compound is classified as a thione due to the presence of a sulfur atom in the triazole ring, which can affect its reactivity and stability. It may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. The compound's molecular structure suggests potential applications in areas such as antifungal or antibacterial research, although specific biological activities would require empirical investigation. As with many synthetic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species.
Formula:C13H15FN4S
InChI:InChI=1S/C13H15FN4S/c14-10-3-5-11(6-4-10)18-12(15-16-13(18)19)9-17-7-1-2-8-17/h3-6H,1-2,7-9H2,(H,16,19)
InChI key:InChIKey=UAPLPNZCZVOQLO-UHFFFAOYSA-N
SMILES:C(C=1N(C(=S)NN1)C2=CC=C(F)C=C2)N3CCCC3
Synonyms:
  • 4-(4-Fluorophenyl)-2,4-dihydro-5-(1-pyrrolidinylmethyl)-3H-1,2,4-triazole-3-thione
  • 3H-1,2,4-Triazole-3-thione, 4-(4-fluorophenyl)-2,4-dihydro-5-(1-pyrrolidinylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.