
CAS 790263-79-5
:2-Chloro-N-[2,5-diethoxy-4-(4-morpholinyl)phenyl]propanamide
Description:
2-Chloro-N-[2,5-diethoxy-4-(4-morpholinyl)phenyl]propanamide, identified by its CAS number 790263-79-5, is a synthetic organic compound characterized by its complex molecular structure. It features a chloro substituent, which enhances its reactivity and potential biological activity. The presence of the diethoxy groups contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. The morpholine moiety is known for its role in enhancing pharmacological properties, often contributing to the compound's ability to interact with various biological targets. This compound may exhibit specific therapeutic effects, making it of interest in medicinal chemistry. Its amide functional group suggests potential hydrogen bonding capabilities, which can affect its interaction with biological macromolecules. Overall, the unique combination of functional groups in this compound may lead to diverse applications in drug development and research, although specific biological activities and mechanisms would require further investigation to fully elucidate its potential uses.
Formula:C17H25ClN2O4
InChI:InChI=1S/C17H25ClN2O4/c1-4-23-15-11-14(20-6-8-22-9-7-20)16(24-5-2)10-13(15)19-17(21)12(3)18/h10-12H,4-9H2,1-3H3,(H,19,21)
InChI key:InChIKey=ALZZKNXHCOMPGP-UHFFFAOYSA-N
SMILES:O(CC)C1=C(C=C(OCC)C(NC(C(C)Cl)=O)=C1)N2CCOCC2
Synonyms:- 2-Chloro-N-[2,5-diethoxy-4-(4-morpholinyl)phenyl]propanamide
- Propanamide, 2-chloro-N-[2,5-diethoxy-4-(4-morpholinyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.