CAS 790263-81-9

7-Ethyl-1H-indole-3-carboxaldehyde oxime

Description:

7-Ethyl-1H-indole-3-carboxaldehyde oxime, with the CAS number 790263-81-9, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an ethyl group at the 7-position and an oxime functional group derived from the aldehyde at the 3-position of the indole. The presence of the oxime group indicates that it can participate in various chemical reactions, including those typical of aldehydes and oximes, such as condensation and rearrangement reactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and research. Its solubility, stability, and reactivity can vary depending on the solvent and conditions used. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity. Overall, 7-Ethyl-1H-indole-3-carboxaldehyde oxime represents a unique structure that may have applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₂N₂O

InChI: InChI=1S/C11H12N2O/c1-2-8-4-3-5-10-9(7-13-14)6-12-11(8)10/h3-7,12,14H,2H2,1H3

InChI key: InChIKey=QAIIYIRPHUYFQF-UHFFFAOYSA-N

SMILES: C(=NO)C=1C=2C(=C(CC)C=CC2)NC1

Synonyms:

• 7-Ethyl-1H-indole-3-carboxaldehyde oxime
• 1H-Indole-3-carboxaldehyde, 7-ethyl-, oxime