CymitQuimica logo

CAS 790270-79-0

:

α-(3-Amino-1H-isoindol-1-ylidene)-β-oxo-1-pyrrolidinepropanenitrile

Description:
α-(3-Amino-1H-isoindol-1-ylidene)-β-oxo-1-pyrrolidinepropanenitrile, with the CAS number 790270-79-0, is a chemical compound that features a complex structure incorporating an isoindole moiety, a pyrrolidine ring, and a nitrile functional group. This compound is characterized by its potential biological activity, which may include interactions with various biological targets due to the presence of the amino and nitrile groups. The isoindole structure contributes to its aromatic properties, while the pyrrolidine ring adds to its cyclic nature, influencing its reactivity and solubility. The β-oxo group suggests the presence of a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential pharmacological properties. However, specific details regarding its physical properties, such as melting point, solubility, and spectral data, would require further investigation or reference to specialized chemical databases.
Formula:C15H14N4O
InChI:InChI=1S/C15H14N4O/c16-9-12(15(20)19-7-3-4-8-19)13-10-5-1-2-6-11(10)14(17)18-13/h1-2,5-6H,3-4,7-8H2,(H2,17,18)
InChI key:InChIKey=URYBUGFEPNGKRC-UHFFFAOYSA-N
SMILES:C(C(=O)N1CCCC1)(C#N)=C2C=3C(C(N)=N2)=CC=CC3
Synonyms:
  • Pyrrolidine, 1-[(3-amino-1H-isoindol-1-ylidene)cyanoacetyl]-
  • α-(3-Amino-1H-isoindol-1-ylidene)-β-oxo-1-pyrrolidinepropanenitrile
  • 1-Pyrrolidinepropanenitrile, α-(3-amino-1H-isoindol-1-ylidene)-β-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.