
CAS 790270-95-0
:Ethyl 5-(4-chlorophenyl)-2-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)-3-thiophenecarboxylate
Description:
Ethyl 5-(4-chlorophenyl)-2-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)-3-thiophenecarboxylate is a complex organic compound characterized by its unique structural features, which include a thiophene ring, a pyrrole moiety, and an ethyl ester functional group. The presence of a 4-chlorophenyl substituent enhances its potential for biological activity, possibly influencing its interactions in various chemical environments. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic and aliphatic components, which may affect its solubility in organic solvents. Additionally, the presence of the formyl group suggests potential reactivity, allowing for further chemical modifications. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, as it may possess toxicological properties. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in various fields.
Formula:C20H18ClNO3S
InChI:InChI=1S/C20H18ClNO3S/c1-4-25-20(24)17-10-18(14-5-7-16(21)8-6-14)26-19(17)22-12(2)9-15(11-23)13(22)3/h5-11H,4H2,1-3H3
InChI key:InChIKey=LXCHBELRQSVJFD-UHFFFAOYSA-N
SMILES:CC=1N(C(C)=CC1C=O)C2=C(C(OCC)=O)C=C(S2)C3=CC=C(Cl)C=C3
Synonyms:- Ethyl 5-(4-chlorophenyl)-2-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)-3-thiophenecarboxylate
- 3-Thiophenecarboxylic acid, 5-(4-chlorophenyl)-2-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.