CymitQuimica logo

CAS 790270-99-4

:

1-Propanone, 2-chloro-1-(4-ethoxyphenyl)-

Description:
1-Propanone, 2-chloro-1-(4-ethoxyphenyl)-, also known by its CAS number 790270-99-4, is an organic compound characterized by its ketone functional group and the presence of a chloro substituent on the propanone backbone. This compound features a 4-ethoxyphenyl group, which contributes to its aromatic characteristics and may influence its reactivity and solubility. Typically, compounds of this nature exhibit moderate polarity due to the presence of both hydrophobic aromatic and hydrophilic functional groups. The chloro substituent can enhance the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the ethoxy group may impart certain solubility properties, allowing the compound to dissolve in organic solvents. Overall, this compound's unique structure suggests potential applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing, although specific applications would depend on further research into its properties and behavior in various chemical environments.
Formula:C11H13ClO2
InChI:InChI=1S/C11H13ClO2/c1-3-14-10-6-4-9(5-7-10)11(13)8(2)12/h4-8H,3H2,1-2H3
InChI key:InChIKey=LAMNMHPSWYPAHR-UHFFFAOYSA-N
SMILES:C(C(C)Cl)(=O)C1=CC=C(OCC)C=C1
Synonyms:
  • 1-Propanone, 2-chloro-1-(4-ethoxyphenyl)-
  • 2-Chloro-1-(4-ethoxyphenyl)propan-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.