CAS 790271-05-5

2-Bromo-5-[[(2-methylpropyl)amino]sulfonyl]benzoic acid

Description:

2-Bromo-5-[[(2-methylpropyl)amino]sulfonyl]benzoic acid is a chemical compound characterized by its complex structure, which includes a bromine atom, a sulfonamide functional group, and a carboxylic acid moiety. This compound features a benzoic acid backbone, which is substituted at the 2 and 5 positions, contributing to its unique reactivity and potential biological activity. The presence of the sulfonamide group suggests that it may exhibit properties typical of sulfonamides, such as antibacterial activity. The branched alkyl chain from the 2-methylpropyl group can influence the compound's solubility and lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, the bromine substituent can enhance the compound's reactivity in various chemical reactions, making it a valuable intermediate in organic synthesis. Overall, 2-Bromo-5-[[(2-methylpropyl)amino]sulfonyl]benzoic acid is of interest in medicinal chemistry and may have applications in drug development, particularly in the design of therapeutics targeting specific biological pathways.

Formula: C₁₁H₁₄BrNO₄S

InChI: InChI=1S/C11H14BrNO4S/c1-7(2)6-13-18(16,17)8-3-4-10(12)9(5-8)11(14)15/h3-5,7,13H,6H2,1-2H3,(H,14,15)

InChI key: InChIKey=RZIOAKACLJDKSP-UHFFFAOYSA-N

SMILES: S(NCC(C)C)(=O)(=O)C1=CC(C(O)=O)=C(Br)C=C1

Synonyms:

• Benzoic acid, 2-bromo-5-[[(2-methylpropyl)amino]sulfonyl]-
• 2-Bromo-5-[[(2-methylpropyl)amino]sulfonyl]benzoic acid

2-Bromo-5-[(2-methylpropyl)sulfamoyl]benzoic acid

CAS: 790271-05-5

Versatile small molecule scaffold

Formula: C₁₁H₁₄BrNO₄S

Purity: Min. 95%

Molecular weight: 336.2 g/mol

Ref: 3D-QGB27105