CAS 790271-06-6

2-Bromo-5-[(ethylamino)sulfonyl]benzoic acid

Description:

2-Bromo-5-[(ethylamino)sulfonyl]benzoic acid is an organic compound characterized by its structural features, which include a bromine atom and a sulfonamide functional group attached to a benzoic acid framework. The presence of the bromine substituent typically enhances the compound's reactivity, making it useful in various chemical syntheses. The ethylamino group contributes to the compound's solubility and potential biological activity, as amines can participate in hydrogen bonding and interact with biological targets. The sulfonyl group is known for its ability to stabilize negative charges and can influence the compound's acidity and reactivity. This compound may exhibit properties such as moderate to high solubility in polar solvents, and its acidic nature is attributed to the carboxylic acid group. Overall, 2-Bromo-5-[(ethylamino)sulfonyl]benzoic acid is of interest in medicinal chemistry and materials science, where its unique functional groups can be leveraged for various applications, including drug development and synthesis of complex organic molecules.

Formula: C₉H₁₀BrNO₄S

InChI: InChI=1S/C9H10BrNO4S/c1-2-11-16(14,15)6-3-4-8(10)7(5-6)9(12)13/h3-5,11H,2H2,1H3,(H,12,13)

InChI key: InChIKey=NWFCKUNKCMNENA-UHFFFAOYSA-N

SMILES: S(NCC)(=O)(=O)C1=CC(C(O)=O)=C(Br)C=C1

Synonyms:

• Benzoic acid, 2-bromo-5-[(ethylamino)sulfonyl]-
• 2-Bromo-5-(ethylsulfamoyl)benzoic acid
• 2-Bromo-5-[(ethylamino)sulfonyl]benzoic acid

2-Bromo-5-(ethylsulfamoyl)benzoic acid

CAS: 790271-06-6

Versatile small molecule scaffold

Formula: C₉H₁₀BrNO₄S

Purity: Min. 95%

Molecular weight: 308.15 g/mol

Ref: 3D-QGB27106