CAS 790271-12-4

3-(3-Chloro-5-methoxy-4-propoxyphenyl)-2-propenoic acid

Description:

3-(3-Chloro-5-methoxy-4-propoxyphenyl)-2-propenoic acid, identified by its CAS number 790271-12-4, is an organic compound characterized by its propenoic acid structure, which features a phenyl ring substituted with a chlorine atom, a methoxy group, and a propoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential reactivity due to the presence of the double bond in the propenoic acid moiety. The chlorine substituent can influence the compound's electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. The methoxy and propoxy groups contribute to the compound's hydrophobic characteristics, which may affect its solubility in various solvents. Additionally, the presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions. Overall, this compound may have applications in organic synthesis, pharmaceuticals, or as a biochemical probe, although specific applications would depend on further research into its biological activity and stability.

Formula: C₁₃H₁₅ClO₄

InChI: InChI=1S/C13H15ClO4/c1-3-6-18-13-10(14)7-9(4-5-12(15)16)8-11(13)17-2/h4-5,7-8H,3,6H2,1-2H3,(H,15,16)

InChI key: InChIKey=XYDJPUHQOUOTHP-UHFFFAOYSA-N

SMILES: O(C)C1=C(OCCC)C(Cl)=CC(C=CC(O)=O)=C1

Synonyms:

• 3-(3-Chloro-5-methoxy-4-propoxyphenyl)-2-propenoic acid
• 2-Propenoic acid, 3-(3-chloro-5-methoxy-4-propoxyphenyl)-