CAS 790271-14-6
:N-[4-(Chloromethyl)-2-thiazolyl]-N-(2,4,6-trimethylphenyl)acetamide
Description:
N-[4-(Chloromethyl)-2-thiazolyl]-N-(2,4,6-trimethylphenyl)acetamide is a chemical compound characterized by its thiazole and acetamide functional groups. The presence of a chloromethyl group indicates potential reactivity, making it useful in various synthetic applications. The thiazole ring contributes to the compound's biological activity, often associated with antimicrobial or antifungal properties. The bulky 2,4,6-trimethylphenyl group enhances lipophilicity, which can influence the compound's solubility and permeability in biological systems. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its structure suggests potential applications in drug development, particularly in the design of agents targeting specific enzymes or receptors. As with many synthetic organic compounds, safety and handling precautions are essential due to the presence of chlorine, which can pose hazards. Overall, this compound's unique structural features make it a candidate for further research in pharmacology and organic synthesis.
Formula:C15H17ClN2OS
InChI:InChI=1S/C15H17ClN2OS/c1-9-5-10(2)14(11(3)6-9)18(12(4)19)15-17-13(7-16)8-20-15/h5-6,8H,7H2,1-4H3
InChI key:InChIKey=OSIXKJGYHKWSEA-UHFFFAOYSA-N
SMILES:N(C(C)=O)(C1=C(C)C=C(C)C=C1C)C2=NC(CCl)=CS2
Synonyms:- Acetamide, N-[4-(chloromethyl)-2-thiazolyl]-N-(2,4,6-trimethylphenyl)-
- N-[4-(Chloromethyl)-2-thiazolyl]-N-(2,4,6-trimethylphenyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.