CAS 790271-29-3

2H-Naphth[1,8-cd]isothiazole-2-acetic acid, hydrazide, 1,1-dioxide

Description:

2H-Naphth[1,8-cd]isothiazole-2-acetic acid, hydrazide, 1,1-dioxide is a chemical compound characterized by its unique structure, which includes a naphthalene ring fused with an isothiazole moiety. This compound features a hydrazide functional group, which is known for its reactivity and potential biological activity. The presence of the 1,1-dioxide indicates that the compound may exhibit properties typical of sulfonyl or sulfinyl groups, potentially influencing its solubility and reactivity. Generally, compounds of this nature may be investigated for their pharmacological properties, including antimicrobial or anti-inflammatory activities. The molecular structure suggests that it may participate in various chemical reactions, making it of interest in synthetic organic chemistry. Additionally, the compound's hydrophilic and lipophilic balance could affect its bioavailability and interaction with biological systems. As with many heterocyclic compounds, its specific applications would depend on further research into its chemical behavior and biological effects.

Formula: C₁₂H₁₁N₃O₃S

InChI: InChI=1S/C12H11N3O3S/c13-14-11(16)7-15-9-5-1-3-8-4-2-6-10(12(8)9)19(15,17)18/h1-6H,7,13H2,(H,14,16)

InChI key: InChIKey=NLYCAGZGYKYLSV-UHFFFAOYSA-N

SMILES: C(C(NN)=O)N1C2=C3C(S1(=O)=O)=CC=CC3=CC=C2

Synonyms:

• 2-(1,1-Dioxido-2H-naphtho[1,8-cd]isothiazol-2-yl)acetohydrazide
• 2H-Naphth[1,8-cd]isothiazole-2-acetic acid, hydrazide, 1,1-dioxide