CymitQuimica logo

CAS 790271-43-1

:

2,3,5,6,7,8-Hexahydro-1,3-dioxo-1H-pyrido[1,2-c]pyrimidine-4-carbonitrile

Description:
2,3,5,6,7,8-Hexahydro-1,3-dioxo-1H-pyrido[1,2-c]pyrimidine-4-carbonitrile, with the CAS number 790271-43-1, is a heterocyclic compound characterized by its complex bicyclic structure that incorporates both pyridine and pyrimidine moieties. This compound features a dioxo functional group, which contributes to its reactivity and potential biological activity. The presence of a carbonitrile group enhances its polarity and may influence its solubility in various solvents. Typically, compounds of this nature are investigated for their pharmacological properties, as they may exhibit activities such as antimicrobial, antiviral, or anticancer effects. The hexahydro configuration indicates that the compound is saturated, which can affect its stability and interaction with biological targets. Additionally, the specific arrangement of substituents on the bicyclic framework can lead to diverse chemical behaviors, making it a subject of interest in medicinal chemistry and drug design. Overall, this compound represents a unique class of nitrogen-containing heterocycles with potential applications in various fields of research.
Formula:C9H9N3O2
InChI:InChI=1S/C9H9N3O2/c10-5-6-7-3-1-2-4-12(7)9(14)11-8(6)13/h1-4H2,(H,11,13,14)
InChI key:InChIKey=UDOHDJYYPOIKDP-UHFFFAOYSA-N
SMILES:C(#N)C1=C2N(C(=O)NC1=O)CCCC2
Synonyms:
  • 2,3,5,6,7,8-Hexahydro-1,3-dioxo-1H-pyrido[1,2-c]pyrimidine-4-carbonitrile
  • 1H-Pyrido[1,2-c]pyrimidine-4-carbonitrile, 2,3,5,6,7,8-hexahydro-1,3-dioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.