CAS 790272-31-0

2-Chloro-N-[1-[4-(1-methylethyl)phenyl]ethyl]acetamide

Description:

2-Chloro-N-[1-[4-(1-methylethyl)phenyl]ethyl]acetamide, with the CAS number 790272-31-0, is a chemical compound characterized by its unique structure, which includes a chloro group and an acetamide functional group. This compound features a substituted phenyl ring, specifically a para-isopropyl group, which contributes to its hydrophobic characteristics. The presence of the chloro substituent enhances its reactivity and may influence its biological activity. Typically, compounds of this nature are studied for their potential pharmacological properties, including analgesic or anti-inflammatory effects. The molecular structure suggests that it may interact with biological targets through hydrogen bonding and hydrophobic interactions. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety data and handling precautions are essential due to potential toxicity or reactivity. Overall, 2-Chloro-N-[1-[4-(1-methylethyl)phenyl]ethyl]acetamide represents a class of compounds that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₃H₁₈ClNO

InChI: InChI=1S/C13H18ClNO/c1-9(2)11-4-6-12(7-5-11)10(3)15-13(16)8-14/h4-7,9-10H,8H2,1-3H3,(H,15,16)

InChI key: InChIKey=OEHBKRFGXPACOL-UHFFFAOYSA-N

SMILES: C(NC(CCl)=O)(C)C1=CC=C(C(C)C)C=C1

Synonyms:

• Acetamide, 2-chloro-N-[1-[4-(1-methylethyl)phenyl]ethyl]-
• 2-Chloro-N-[1-[4-(1-methylethyl)phenyl]ethyl]acetamide