
CAS 790272-33-2
:2-(3-Amino-1H-isoindol-1-ylidene)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide
Description:
2-(3-Amino-1H-isoindol-1-ylidene)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide, with the CAS number 790272-33-2, is a synthetic organic compound characterized by its complex molecular structure, which includes an isoindole moiety and a benzodioxin ring. This compound typically exhibits properties such as solubility in organic solvents, and it may have specific reactivity due to the presence of functional groups like the cyano and amide groups. The presence of the amino group suggests potential for hydrogen bonding, which can influence its interactions in biological systems. Its unique structure may confer specific biological activities, making it of interest in medicinal chemistry and drug development. The compound's stability, melting point, and other physical properties would depend on its molecular interactions and the environment in which it is studied. As with many synthetic compounds, safety and handling precautions are essential, and its behavior in biological systems would require thorough investigation to understand its pharmacological potential.
Formula:C19H14N4O3
InChI:InChI=1S/C19H14N4O3/c20-10-14(17-12-3-1-2-4-13(12)18(21)23-17)19(24)22-11-5-6-15-16(9-11)26-8-7-25-15/h1-6,9H,7-8H2,(H2,21,23)(H,22,24)
InChI key:InChIKey=VURUBVAATSQDID-UHFFFAOYSA-N
SMILES:C(C(NC=1C=C2C(=CC1)OCCO2)=O)(C#N)=C3C=4C(C(N)=N3)=CC=CC4
Synonyms:- 2-(3-Amino-1H-isoindol-1-ylidene)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide
- Acetamide, 2-(3-amino-1H-isoindol-1-ylidene)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.