CAS 790272-37-6

Acetamide, 2-chloro-N-[1-(2-methylphenyl)ethyl]-

Description:

Acetamide, 2-chloro-N-[1-(2-methylphenyl)ethyl]- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a chloro substituent at the second position of the acetamide structure, contributing to its reactivity and potential applications in various chemical reactions. The presence of the 2-methylphenyl group indicates that it has an aromatic character, which can influence its physical and chemical properties, such as solubility and stability. Typically, compounds like this may exhibit moderate polarity due to the amide group, affecting their interactions with solvents and biological systems. The specific arrangement of atoms and functional groups in this compound suggests potential uses in pharmaceuticals or as intermediates in organic synthesis. However, detailed information regarding its toxicity, environmental impact, and specific applications would require further investigation and analysis. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the realm of substituted amides.

Formula: C₁₁H₁₄ClNO

InChI: InChI=1S/C11H14ClNO/c1-8-5-3-4-6-10(8)9(2)13-11(14)7-12/h3-6,9H,7H2,1-2H3,(H,13,14)

InChI key: InChIKey=NHFCHQWSQVZWAD-UHFFFAOYSA-N

SMILES: C(NC(CCl)=O)(C)C1=C(C)C=CC=C1

Synonyms:

• Acetamide, 2-chloro-N-[1-(2-methylphenyl)ethyl]-