CAS 79035-06-6

Gibbane-1,10-dicarboxylic acid, 2,4a-dihydroxy-1,3,3-trimethyl-8-methylene-, 1,4a-lactone, (1α,2β,4aα,4bβ,10β)-

Description:

Gibbane-1,10-dicarboxylic acid, 2,4a-dihydroxy-1,3,3-trimethyl-8-methylene-, 1,4a-lactone, with the CAS number 79035-06-6, is a complex organic compound characterized by its unique structural features, including multiple functional groups such as carboxylic acids and hydroxyl groups. This compound belongs to a class of molecules known as lactones, which are cyclic esters formed from the condensation of hydroxy acids. The presence of multiple methyl groups contributes to its hydrophobic character, while the dicarboxylic acid functionality enhances its potential for hydrogen bonding and solubility in polar solvents. The stereochemistry indicated by the specific alpha and beta designations suggests that the compound exhibits chirality, which may influence its biological activity and interactions with other molecules. Gibbane derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis, owing to their diverse reactivity and structural complexity.

Formula: C₂₁H₂₈O₅

InChI: InChI=1S/C21H28O5/c1-10-7-20-8-11(10)5-6-12(20)21-9-18(2,3)16(24)19(4,17(25)26-21)14(21)13(20)15(22)23/h11-14,16,24H,1,5-9H2,2-4H3,(H,22,23)/t11?,12-,13-,14-,16+,19+,20+,21-/m1/s1

InChI key: InChIKey=FGSSZPPPKWMFHU-YFYPMIKBSA-N

SMILES: C(O)(=O)[C@H]1[C@]2([C@]3([C@]4([C@]15CC(CC4)(C(=C)C5)[H])[H])CC(C)(C)[C@H](O)[C@@]2(C)C(=O)O3)[H]

Synonyms:

• Gibbane-1,10-dicarboxylic acid, 2,4a-dihydroxy-1,3,3-trimethyl-8-methylene-, 1,4a-lactone, (1α,2β,4aα,4bβ,10β)-
• 2,2-Dimethyl GA4

2,2-Dimethyl Gibberellin A4

Controlled Product

CAS: 79035-06-6

Formula: C₂₁H₂₈O₅

Color and Shape: Neat

Molecular weight: 360.444

Ref: TR-D473085