CAS 79037-32-4

(3S,5S,10S,13S,17S)-16,16,17-trideuterio-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol

Description:

The chemical substance with the name "(3S,5S,10S,13S,17S)-16,16,17-trideuterio-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol" and CAS number "79037-32-4" is a complex organic compound characterized by its polycyclic structure, which includes multiple fused rings typical of steroid-like compounds. The presence of deuterium atoms indicates that it is a labeled compound, often used in research to trace metabolic pathways or in studies involving isotopic effects. The stereochemistry is specified by the (3S,5S,10S,13S,17S) configuration, indicating specific spatial arrangements of the atoms, which can significantly influence the compound's biological activity and interactions. The compound features hydroxyl (-OH) groups, contributing to its potential solubility in polar solvents and reactivity in various chemical reactions. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a biochemical probe. Overall, this compound exemplifies the intricate nature of organic molecules and their diverse functionalities in chemical and biological systems.

Formula: C₁₉H₂₉D₃O₂

InChI: InChI=1/C19H32O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-17,20-21H,3-11H2,1-2H3/t12-,13-,14?,15?,16?,17-,18-,19-/m0/s1/i6D2,17D

SMILES: C[C@]12CC[C@@H](C[C@@H]1CCC1C3CC([C@@]([C@@]3(C)CCC21)(O)[2H])([2H])[2H])O

5α-Androstan-3β,17β-diol-16,16,17-d3

Controlled Product

CAS: 79037-32-4

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 295.48

Ref: 3U-D5409

5α-Androstan-3β,17β-diol-16,16,17-d3

Controlled Product

CAS: 79037-32-4

Applications Labelled 5α-Androstane-3β,17β-diol, a metabolite of Testosterone (T155000).
References Monetti, G., et al.: J. Steroid Biochem., 25, 765 (1986),

Formula: C₁₉₂H₃H₂₉O₂

Color and Shape: Neat

Molecular weight: 295.40

Ref: TR-A637527