CAS 790601-53-5

4-(1,1-Difluoroethyl)benzenemethanamine

Description:

4-(1,1-Difluoroethyl)benzenemethanamine, identified by its CAS number 790601-53-5, is an organic compound characterized by the presence of a benzene ring substituted with an amine group and a difluoroethyl group. This compound features a primary amine functional group, which can participate in hydrogen bonding, influencing its solubility and reactivity. The difluoroethyl substituent introduces significant steric and electronic effects, potentially affecting the compound's chemical behavior and interactions. Typically, compounds like this may exhibit moderate polarity due to the presence of both the aromatic system and the amine group, which can impact their solubility in various solvents. Additionally, the difluoroethyl group can enhance lipophilicity, making the compound of interest in medicinal chemistry and material science. The specific properties, such as boiling point, melting point, and reactivity, would depend on the molecular structure and the environment in which the compound is studied. Overall, this compound may have applications in pharmaceuticals or as an intermediate in organic synthesis.

Formula: C₉H₁₁F₂N

InChI: InChI=1S/C9H11F2N/c1-9(10,11)8-4-2-7(6-12)3-5-8/h2-5H,6,12H2,1H3

InChI key: InChIKey=COSPLSAVKJQASZ-UHFFFAOYSA-N

SMILES: C(C)(F)(F)C1=CC=C(CN)C=C1

Synonyms:

• 4-(1,1-Difluoroethyl)benzenemethanamine
• [4-(1,1-Difluoroethyl)phenyl]methanamine
• Benzenemethanamine, 4-(1,1-difluoroethyl)-

[4-(1,1-Difluoroethyl)phenyl]methanamine

CAS: 790601-53-5

Versatile small molecule scaffold

Formula: C₉H₁₁F₂N

Purity: Min. 95%

Molecular weight: 171.19 g/mol

Ref: 3D-QGB60153