CAS 79064-26-9

9-benzyl-2,6-dichloro-9H-purine

Description:

9-Benzyl-2,6-dichloro-9H-purine is a purine derivative characterized by its unique structural features, including a purine core substituted with a benzyl group and two chlorine atoms at the 2 and 6 positions. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its non-polar characteristics due to the presence of the benzyl group. The dichloro substitutions enhance its reactivity and may influence its biological activity, making it of interest in medicinal chemistry, particularly in the development of antiviral or anticancer agents. Its molecular structure allows for potential interactions with biological macromolecules, which can be explored in various pharmacological contexts. Additionally, the presence of chlorine atoms can affect the compound's lipophilicity and metabolic stability. As with many purine derivatives, it may exhibit nucleoside-like properties, which can be relevant in biochemical applications. Safety and handling precautions should be observed due to the potential toxicity associated with chlorine-containing compounds.

Formula: C₁₂H₈Cl₂N₄

InChI: InChI=1/C12H8Cl2N4/c13-10-9-11(17-12(14)16-10)18(7-15-9)6-8-4-2-1-3-5-8/h1-5,7H,6H2

SMILES: c1ccc(cc1)Cn1cnc2c(Cl)nc(Cl)nc12

Synonyms:

• 9H-purine, 2,6-dichloro-9-(phenylmethyl)-

9-Benzyl-2,6-dichloro-9H-purine

CAS: 79064-26-9

Formula: C₁₂H₈Cl₂N₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 279.1247

Ref: IN-DA0053VW

9-Benzyl-2,6-dichloro-9H-purine

CAS: 79064-26-9

9-Benzyl-2,6-dichloro-9H-purine

Purity: 96%

Molecular weight: 279.12g/mol

Ref: 54-OR96589

9-Benzyl-2,6-dichloro-9H-purine

CAS: 79064-26-9

Formula: C₁₂H₈Cl₂N₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 279.12

Ref: 10-F234545