CAS 790646-62-7
:4-(trifluoromethyl)-1,2,3,6-tetrahydropyridine
Description:
4-(Trifluoromethyl)-1,2,3,6-tetrahydropyridine is a heterocyclic organic compound characterized by a tetrahydropyridine ring substituted with a trifluoromethyl group. This compound features a six-membered ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The trifluoromethyl group is known for its electron-withdrawing properties, which can significantly influence the compound's chemical behavior, including its reactivity and solubility. Typically, compounds with such substituents exhibit unique pharmacological properties, making them of interest in medicinal chemistry. The presence of the tetrahydropyridine structure suggests potential applications in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would be influenced by the trifluoromethyl group, which can enhance lipophilicity. Overall, 4-(trifluoromethyl)-1,2,3,6-tetrahydropyridine is a compound of interest for further research in organic synthesis and drug development due to its unique structural features and potential biological activity.
Formula:C6H8F3N
InChI:InChI=1/C6H8F3N/c7-6(8,9)5-1-3-10-4-2-5/h1,10H,2-4H2
SMILES:C1=C(CCNC1)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.