CAS 790654-82-9
:5-(chloromethyl)-1-ethyl-imidazole
Description:
5-(Chloromethyl)-1-ethyl-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a chloromethyl group (-CH2Cl) at the 5-position and an ethyl group (-C2H5) at the 1-position of the imidazole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the chloromethyl group makes it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The ethyl group enhances the lipophilicity of the molecule, which may influence its solubility and interaction with biological systems. This compound is typically handled with care due to the presence of the chlorine atom, which can impart toxicity and reactivity. Overall, 5-(chloromethyl)-1-ethyl-imidazole is of interest in medicinal chemistry and materials science, where it may serve as a building block for more complex molecules or as a potential pharmacophore in drug development.
Formula:C6H9ClN2
InChI:InChI=1/C6H9ClN2/c1-2-9-5-8-4-6(9)3-7/h4-5H,2-3H2,1H3
SMILES:CCn1cncc1CCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.