CAS 790667-67-3

3-[(1-Ethyl-4-piperidinyl)oxy]benzenamine

Description:

3-[(1-Ethyl-4-piperidinyl)oxy]benzenamine, identified by its CAS number 790667-67-3, is a chemical compound characterized by its structural features that include a benzene ring substituted with an amino group and an ether linkage to a piperidine derivative. This compound typically exhibits properties associated with both aromatic amines and piperidine derivatives, which may influence its solubility, reactivity, and biological activity. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may confer specific pharmacological properties, including potential use in therapeutic applications. Additionally, the compound's stability, reactivity, and interaction with other substances can be influenced by factors such as pH and temperature. As with many organic compounds, safety considerations regarding handling and exposure are essential, particularly due to the presence of the amine group, which can be reactive. Overall, 3-[(1-Ethyl-4-piperidinyl)oxy]benzenamine represents a unique chemical entity with potential applications in various fields, including pharmaceuticals.

Formula: C₁₃H₂₀N₂O

InChI: InChI=1S/C13H20N2O/c1-2-15-8-6-12(7-9-15)16-13-5-3-4-11(14)10-13/h3-5,10,12H,2,6-9,14H2,1H3

InChI key: InChIKey=MWCCJRLJIICLGF-UHFFFAOYSA-N

SMILES: O(C1CCN(CC)CC1)C2=CC(N)=CC=C2

Synonyms:

• 3-[(1-Ethylpiperidin-4-yl)oxy]phenylamine
• 3-[(1-Ethylpiperidin-4-yl)oxy]aniline
• Benzenamine, 3-[(1-ethyl-4-piperidinyl)oxy]-
• 3-[(1-Ethyl-4-piperidinyl)oxy]benzenamine