CAS 790674-48-5
:2,2'-Diiodo-9,9'-spirobi[fluorene]
Description:
2,2'-Diiodo-9,9'-spirobi[fluorene] is an organic compound characterized by its unique spirobifluorene structure, which consists of two fluorene units connected by a spiro carbon atom. This compound features two iodine atoms attached to the 2-position of the fluorene moieties, which significantly influences its chemical properties and reactivity. The presence of iodine atoms enhances its potential for applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics, due to their ability to facilitate charge transport and improve device performance. Additionally, the compound exhibits notable thermal stability and can be synthesized through various methods, including halogenation of spirobifluorene derivatives. Its molecular structure contributes to interesting optical properties, making it a subject of study in materials science and organic chemistry. Overall, 2,2'-Diiodo-9,9'-spirobi[fluorene] is a significant compound in the field of organic materials, with potential applications in advanced electronic devices.
Formula:C25H14I2
InChI:InChI=1S/C25H14I2/c26-15-9-11-19-17-5-1-3-7-21(17)25(23(19)13-15)22-8-4-2-6-18(22)20-12-10-16(27)14-24(20)25/h1-14H
SMILES:c1ccc2c(c1)c1ccc(cc1C12c2ccccc2c2ccc(cc12)I)I
Synonyms:- K0032
- 2,2'-Diiodo-9,9'-spirobifluorene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2'-Diiodo-9,9'-spirobi[fluorene]
CAS:Formula:C25H14I2Color and Shape:SolidMolecular weight:568.1876
