CymitQuimica logo

CAS 790681-97-9

:

3-(4-Bromo-3-chlorophenyl)-2-propenoic acid

Description:
3-(4-Bromo-3-chlorophenyl)-2-propenoic acid, with the CAS number 790681-97-9, is an organic compound characterized by its propenoic acid structure, which features a double bond between the second and third carbon atoms of the propene chain. The presence of a 4-bromo and a 3-chloro substituent on the phenyl ring contributes to its unique chemical properties, including increased reactivity and potential for various chemical transformations. This compound is likely to exhibit acidic behavior due to the carboxylic acid functional group, which can donate protons in solution. Its halogen substituents may influence its solubility, stability, and reactivity, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications. Additionally, the compound's structure suggests it may participate in electrophilic aromatic substitution reactions and other mechanisms typical of compounds with similar functional groups. Overall, its distinctive features make it a valuable compound for research and development in various chemical fields.
Formula:C9H6BrClO2
InChI:InChI=1S/C9H6BrClO2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)
InChI key:InChIKey=TZPKGXJKJIOUNI-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=CC(Cl)=C(Br)C=C1
Synonyms:
  • 3-(4-Bromo-3-chlorophenyl)-2-propenoic acid
  • 2-Propenoic acid, 3-(4-bromo-3-chlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.