CymitQuimica logo

CAS 790689-63-3

:

(2R,5R)-5-Methyl-2-pyrrolidinemethanol

Description:
(2R,5R)-5-Methyl-2-pyrrolidinemethanol is a chiral organic compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. The presence of a hydroxymethyl group (-CH2OH) at the 2-position and a methyl group (-CH3) at the 5-position contributes to its unique stereochemistry and potential biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents such as water and alcohols, which is indicative of its functional groups. The compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its chirality suggests that it may have different biological activities depending on the stereoisomer, which is crucial in drug development. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory settings.
Formula:C6H13NO
InChI:InChI=1S/C6H13NO/c1-5-2-3-6(4-8)7-5/h5-8H,2-4H2,1H3/t5-,6-/m1/s1
InChI key:InChIKey=JMGBOXZFLWUSLH-PHDIDXHHSA-N
SMILES:C(O)[C@@H]1N[C@H](C)CC1
Synonyms:
  • 2-Pyrrolidinemethanol, 5-methyl-, (2R,5R)-
  • (2R,5R)-5-Methyl-2-pyrrolidinemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.