CAS 79069-50-4
:N-T-boc-L-alaninal
Description:
N-T-boc-L-alaninal is a chemical compound characterized by its structure, which includes a tert-butyloxycarbonyl (Boc) protecting group attached to the amino group of L-alanine, along with an aldehyde functional group. This compound is typically used in organic synthesis, particularly in peptide chemistry, as the Boc group serves to protect the amine during various reactions. The presence of the aldehyde functional group allows for further reactivity, enabling the compound to participate in condensation reactions or serve as an intermediate in the synthesis of more complex molecules. N-T-boc-L-alaninal is generally a white to off-white solid and is soluble in organic solvents such as dichloromethane and methanol. Its stability can be influenced by factors such as pH and temperature, making it essential to handle it under appropriate conditions to maintain its integrity. As with many chemical substances, safety precautions should be observed when handling N-T-boc-L-alaninal, including the use of personal protective equipment to avoid exposure.
Formula:C8H15NO3
InChI:InChI=1/C8H15NO3/c1-6(5-10)9-7(11)12-8(2,3)4/h5-6H,1-4H3,(H,9,11)/t6-/m0/s1
SMILES:C[C@@H](C=O)N=C(O)OC(C)(C)C
Synonyms:- Boc-L-alaninal
- tert-butyl [(1S)-1-methyl-2-oxoethyl]carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Boc-Ala-aldehyde
CAS:Boc-L-alaninal.Formula:C8H15NO3Purity:> 98%Color and Shape:White PowderMolecular weight:173.21Ref: IN-DA0034JY
1g49.00€5g111.00€10g146.00€25g208.00€50g322.00€100g664.00€250gTo inquire500gTo inquire100mg25.00€250mg26.00€Boc-L-alanine aldehyde
CAS:<p>Boc-L-alanine aldehyde is an isostere that can be used as a replacement for the amino acid L-alanine. It has been shown to have clinical use in the treatment of various diseases, including cancer, although it is not labelled for use. Boc-L-alanine aldehyde is synthesized by oxidation of L-alanine and its stereoselective synthesis has been demonstrated by ion exchange chromatography. The biosynthesis of this molecule has also been modeled using molecular modelling techniques. Boc-L-alanine aldehyde was modelled using quantum chemical calculations and was found to be enantiopure. This molecule can be used as the building block for peptidomimetics, which are molecules that mimic peptides with biological activity. Catalysis of this molecule has also been studied extensively.</p>Formula:C8H15NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:173.21 g/mol(S)-tert-Butyl (1-oxopropan-2-yl)carbamate
CAS:Formula:C8H15NO3Purity:97.0%Color and Shape:SolidMolecular weight:173.212





