CymitQuimica logo

CAS 79069-50-4

:

N-T-boc-L-alaninal

Description:
N-T-boc-L-alaninal is a chemical compound characterized by its structure, which includes a tert-butyloxycarbonyl (Boc) protecting group attached to the amino group of L-alanine, along with an aldehyde functional group. This compound is typically used in organic synthesis, particularly in peptide chemistry, as the Boc group serves to protect the amine during various reactions. The presence of the aldehyde functional group allows for further reactivity, enabling the compound to participate in condensation reactions or serve as an intermediate in the synthesis of more complex molecules. N-T-boc-L-alaninal is generally a white to off-white solid and is soluble in organic solvents such as dichloromethane and methanol. Its stability can be influenced by factors such as pH and temperature, making it essential to handle it under appropriate conditions to maintain its integrity. As with many chemical substances, safety precautions should be observed when handling N-T-boc-L-alaninal, including the use of personal protective equipment to avoid exposure.
Formula:C8H15NO3
InChI:InChI=1/C8H15NO3/c1-6(5-10)9-7(11)12-8(2,3)4/h5-6H,1-4H3,(H,9,11)/t6-/m0/s1
InChI key:OEQRZPWMXXJEKU-LURJTMIESA-N
SMILES:C[C@@H](C=O)N=C(O)OC(C)(C)C
Synonyms:
  • Boc-L-alaninal
  • tert-butyl [(1S)-1-methyl-2-oxoethyl]carbamate
Found 6 products.