CAS 79069-97-9
:sodium 2-tetradecyloxirane-2-carboxylate dihydrate
Description:
Sodium 2-tetradecyloxirane-2-carboxylate dihydrate, with the CAS number 79069-97-9, is a chemical compound characterized by its surfactant properties, which are attributed to its amphiphilic structure. This compound features a long hydrophobic tetradecyl chain and a hydrophilic carboxylate group, making it effective in reducing surface tension in aqueous solutions. The presence of the oxirane (epoxide) group contributes to its reactivity, allowing for potential applications in polymer synthesis and as a stabilizing agent in emulsions. As a dihydrate, it contains two molecules of water per formula unit, which can influence its solubility and stability. This compound is typically used in various industrial applications, including detergents, emulsifiers, and in the formulation of personal care products. Its properties, such as solubility in water and compatibility with other surfactants, make it valuable in both laboratory and commercial settings. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C17H35NaO5
InChI:InChI=1/C17H32O3.Na.2H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(15-20-17)16(18)19;;;/h2-15H2,1H3,(H,18,19);;2*1H2/q;+1;;/p-1
Synonyms:- (±)-2-Tetradecyloxiranecarboxylic Acid Sodium Salt Dihydrate
- McN 3802-21-98
- Sodium (±)-2Tetradecylglycidate Dihydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Palmoxirate sodium hydrate
CAS:Palmoxirate sodium hydrate is a potent inhibitor of long-chain fatty acid oxidation.Formula:C17H35NaO5Color and Shape:SolidMolecular weight:342.45
