CAS 790725-72-3

2-[[[(4-Fluorophenyl)sulfonyl]amino]oxy]acetic acid

Description:

2-[[[(4-Fluorophenyl)sulfonyl]amino]oxy]acetic acid, identified by its CAS number 790725-72-3, is a chemical compound characterized by its unique functional groups and structural features. It contains a sulfonamide moiety, which is known for its biological activity, particularly in pharmaceuticals. The presence of a fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit properties such as solubility in polar solvents due to the carboxylic acid group, while the sulfonyl and amino functionalities may contribute to its reactivity and potential as a ligand in various chemical reactions. Additionally, the compound may possess specific pharmacological properties, making it of interest in medicinal chemistry. Its structural complexity suggests potential applications in drug development, particularly in targeting specific enzymes or receptors. Overall, 2-[[[(4-Fluorophenyl)sulfonyl]amino]oxy]acetic acid represents a versatile scaffold for further exploration in chemical and biological research.

Formula: C₈H₈FNO₅S

InChI: InChI=1S/C8H8FNO5S/c9-6-1-3-7(4-2-6)16(13,14)10-15-5-8(11)12/h1-4,10H,5H2,(H,11,12)

InChI key: InChIKey=JYCJJJKCRVCGKY-UHFFFAOYSA-N

SMILES: S(NOCC(O)=O)(=O)(=O)C1=CC=C(F)C=C1

Synonyms:

• Acetic acid, 2-[[[(4-fluorophenyl)sulfonyl]amino]oxy]-
• 2-[[[(4-Fluorophenyl)sulfonyl]amino]oxy]acetic acid
• Acetic acid, [[[(4-fluorophenyl)sulfonyl]amino]oxy]-