CAS 79080-37-8

1,5-Dimethyl-1H-imidazole-2-carbonitrile

Description:

1,5-Dimethyl-1H-imidazole-2-carbonitrile is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features two methyl groups attached to the first carbon of the imidazole ring and a cyano group (-C≡N) at the second carbon. The presence of the cyano group contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its chemical properties are influenced by the electron-withdrawing nature of the cyano group and the electron-donating effects of the methyl groups, which can affect its acidity and basicity. Additionally, 1,5-Dimethyl-1H-imidazole-2-carbonitrile may serve as a building block in the synthesis of more complex molecules, making it of interest in various fields, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₆H₇N₃

InChI: InChI=1S/C6H7N3/c1-5-4-8-6(3-7)9(5)2/h4H,1-2H3

InChI key: InChIKey=HBTVJZJUISVKIC-UHFFFAOYSA-N

SMILES: C(#N)C=1N(C)C(C)=CN1

Synonyms:

• 1,5-Dimethyl-1H-imidazole-2-carbonitrile
• 1H-Imidazole-2-carbonitrile,1,5-dimethyl-(9CI)
• 1H-Imidazole-2-carbonitrile, 1,5-dimethyl-